Skip to main content
ScotlandMathsSyllabus dot point

How do the compound angle formulae let you expand and simplify trigonometric expressions, and how does the wave function combine a sine and a cosine into one?

The addition (compound angle) formulae for sine and cosine, the double angle formulae, their use in proving identities and solving equations, and the wave function that expresses a sin x plus b cos x in the form k sin of x plus a.

A focused answer to the SQA Higher Mathematics addition formulae content, covering the compound and double angle formulae for sine and cosine, their use in proving identities and solving equations, and the wave function that writes a sin x plus b cos x as a single sine wave.

Generated by Claude Opus 4.89 min answer

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

Jump to a section
  1. What this dot point is asking
  2. The compound and double angle formulae
  3. The wave function
  4. Examples in context
  5. Try this

What this dot point is asking

The SQA wants you to use the compound angle (addition) formulae for sine and cosine, apply the double angle formulae, prove identities and solve equations with them, and express asinx+bcosxa\sin x + b\cos x as a single wave in the form ksin(x+α)k\sin(x + \alpha).

The compound and double angle formulae

The compound angle formulae expand the sine or cosine of a sum or difference of two angles. Setting the two angles equal collapses them into the double angle formulae, which are the workhorse for proving identities, evaluating exact values and reducing equations.

The three forms of cos2A\cos 2A let you choose the one that matches the rest of an equation: use 2cos2A12\cos^2 A - 1 when the equation involves cosA\cos A, and 12sin2A1 - 2\sin^2 A when it involves sinA\sin A.

The wave function

The wave function rewrites a sum asinx+bcosxa\sin x + b\cos x as a single sine wave ksin(x+α)k\sin(x + \alpha), which makes the amplitude and the location of the maximum obvious. You find kk from a2+b2\sqrt{a^2 + b^2} and the auxiliary angle α\alpha by matching the expanded form, taking care to place α\alpha in the quadrant fixed by the signs of aa and bb.

The wave form makes the maximum value (kk) and where it occurs easy to read off: the maximum is kk, reached when the bracket equals 9090^\circ (or π2\dfrac{\pi}{2}).

Examples in context

The wave function combines two oscillations of the same frequency into one. If two forces vary as 3sinωt3\sin\omega t and 4cosωt4\cos\omega t, their sum is 5sin(ωt+53.1)5\sin(\omega t + 53.1^\circ), a single oscillation of amplitude 55. An engineer reads the resultant amplitude directly as k=32+42=5k = \sqrt{3^2 + 4^2} = 5 and the phase lead as α\alpha, without resolving components every cycle.

Try this

Q1. Expand sin(x+30)\sin(x + 30^\circ) using the addition formula. [2 marks]

  • Cue. sinxcos30+cosxsin30=32sinx+12cosx\sin x\cos 30^\circ + \cos x\sin 30^\circ = \dfrac{\sqrt{3}}{2}\sin x + \dfrac{1}{2}\cos x.

Q2. Write sinx+3cosx\sin x + \sqrt{3}\cos x in the form ksin(x+α)k\sin(x + \alpha). [3 marks]

  • Cue. k=1+3=2k = \sqrt{1 + 3} = 2, tanα=3\tan\alpha = \sqrt{3}, so 2sin(x+60)2\sin(x + 60^\circ).

Exam-style practice questions

Practice questions written in the style of SQA exam questions on this dot point, with worked answer explainers. The year tag is the paper they imitate, not the source.

SQA Higher 20194 marksGiven that sinA=35\sin A = \dfrac{3}{5} where AA is acute, find the exact value of sin2A\sin 2A and cos2A\cos 2A.
Show worked answer →

Find cosA\cos A first. Since sinA=35\sin A = \dfrac{3}{5} and AA is acute, cosA=1sin2A=1925=1625=45\cos A = \sqrt{1 - \sin^2 A} = \sqrt{1 - \dfrac{9}{25}} = \sqrt{\dfrac{16}{25}} = \dfrac{4}{5} (1 mark).

sin2A=2sinAcosA=23545=2425\sin 2A = 2\sin A\cos A = 2 \cdot \dfrac{3}{5} \cdot \dfrac{4}{5} = \dfrac{24}{25} (1 mark).

cos2A=12sin2A=12(925)=11825=725\cos 2A = 1 - 2\sin^2 A = 1 - 2\left(\dfrac{9}{25}\right) = 1 - \dfrac{18}{25} = \dfrac{7}{25} (2 marks). Markers reward cosA\cos A from the identity, sin2A\sin 2A from the double-angle formula, and cos2A\cos 2A from any valid form.

SQA Higher 20215 marksExpress 3sinxcosx\sqrt{3}\sin x - \cos x in the form ksin(x+α)k\sin(x + \alpha), where k>0k > 0 and 0α<2π0 \le \alpha < 2\pi, and hence state the maximum value of the expression and the value of xx at which it first occurs.
Show worked answer →

Amplitude: k=(3)2+(1)2=3+1=2k = \sqrt{(\sqrt{3})^2 + (-1)^2} = \sqrt{3 + 1} = 2 (1 mark).

Expand ksin(x+α)=ksinxcosα+kcosxsinαk\sin(x + \alpha) = k\sin x\cos\alpha + k\cos x\sin\alpha and compare: kcosα=3k\cos\alpha = \sqrt{3} and ksinα=1k\sin\alpha = -1 (1 mark). So cosα=32>0\cos\alpha = \dfrac{\sqrt{3}}{2} > 0 and sinα=12<0\sin\alpha = -\dfrac{1}{2} < 0, placing α\alpha in the fourth quadrant: α=2ππ6=11π6\alpha = 2\pi - \dfrac{\pi}{6} = \dfrac{11\pi}{6} (2 marks).

So 3sinxcosx=2sin ⁣(x+11π6)\sqrt{3}\sin x - \cos x = 2\sin\!\left(x + \dfrac{11\pi}{6}\right). The maximum value is k=2k = 2, occurring when sin(x+α)=1\sin(x + \alpha) = 1, i.e. x+11π6=π2x + \dfrac{11\pi}{6} = \dfrac{\pi}{2}, giving x=π211π6=8π6=4π3x = \dfrac{\pi}{2} - \dfrac{11\pi}{6} = -\dfrac{8\pi}{6} = -\dfrac{4\pi}{3}, or adding 2π2\pi, x=2π3x = \dfrac{2\pi}{3} (1 mark). Markers reward kk, the quadrant for α\alpha from both signs, and the maximum with its location.

Related dot points

Sources & how we know this