Skip to main content
EnglandChemistrySyllabus dot point

How are amines made and why do they behave as bases and nucleophiles?

Amines as bases and nucleophiles. Preparation of aliphatic amines by reaction of halogenoalkanes with ammonia and by reduction of nitriles. Preparation of aromatic amines by reduction of nitro compounds. The relative base strength of ammonia, primary aliphatic and aromatic amines. Amines as nucleophiles in further substitution.

A focused answer to the AQA A-Level Chemistry 3.3.12 specification points on amines. Covers preparation of aliphatic and aromatic amines, their behaviour as bases, the order of base strength, and their reactions as nucleophiles.

Generated by Claude Opus 4.810 min answer

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

Jump to a section
  1. What this dot point is asking
  2. Preparation of amines
  3. Base strength
  4. Amines as nucleophiles
  5. Try this

What this dot point is asking

AQA wants you to prepare aliphatic amines from halogenoalkanes and nitriles and aromatic amines from nitro compounds, explain why amines are bases, rank the base strengths of ammonia and primary aliphatic and aromatic amines, and explain amines acting as nucleophiles.

Preparation of amines

From halogenoalkanes (excess ammonia): nucleophilic substitution gives a primary amine, then further substitution gives secondary, tertiary amines and quaternary ammonium salts. Excess ammonia favours the primary amine.

CH3CH2Br+2NH3CH3CH2NH2+NH4BrCH_3CH_2Br + 2NH_3 \rightarrow CH_3CH_2NH_2 + NH_4Br

By reduction of nitriles: a nitrile is reduced (using LiAlH4LiAlH_4, or H2H_2 with a nickel catalyst) to a primary amine. This usefully adds a carbon to the chain.

CH3CN+4[H]CH3CH2NH2CH_3CN + 4[H] \rightarrow CH_3CH_2NH_2

Aromatic amines: nitrobenzene is reduced with tin and concentrated hydrochloric acid, then made alkaline with NaOHNaOH, to give phenylamine.

C6H5NO2+6[H]C6H5NH2+2H2OC_6H_5NO_2 + 6[H] \rightarrow C_6H_5NH_2 + 2H_2O

The choice of preparation depends on the target. Using excess ammonia with a halogenoalkane is cheap but gives a mixture of primary, secondary and tertiary amines plus a quaternary salt, because each amine product is itself a nucleophile that can react further; excess ammonia simply makes the primary amine the largest fraction. The nitrile route is cleaner and is the one to choose when the carbon chain needs to be extended by one, since the cyanide adds a carbon and the subsequent reduction converts the nitrile group to a primary amine without further substitution.

Base strength

  • Aliphatic amines are stronger bases than ammonia: the alkyl group is electron-releasing (positive inductive effect), increasing electron density on the nitrogen so the lone pair is more available.
  • Aromatic amines (phenylamine) are weaker bases than ammonia: the nitrogen lone pair is partly delocalised into the benzene ring, so it is less available to accept a proton.

Amines as nucleophiles

The lone pair lets amines act as nucleophiles. They react with halogenoalkanes (further alkylation, adding alkyl groups one at a time up to a quaternary ammonium salt) and with acyl chlorides to form N-substituted amides, e.g.

CH3COCl+CH3NH2CH3CONHCH3+HClCH_3COCl + CH_3NH_2 \rightarrow CH_3CONHCH_3 + HCl

The same basicity explains a simple reaction with acids: an amine reacts with hydrochloric acid to form a soluble salt, for example CH3CH2NH2+HClCH3CH2NH3+Cl\text{CH}_3\text{CH}_2\text{NH}_2 + \text{HCl} \rightarrow \text{CH}_3\text{CH}_2\text{NH}_3^+\text{Cl}^- (ethylammonium chloride). This is reversed by adding a stronger base such as sodium hydroxide, which deprotonates the salt and regenerates the free amine, and is the step used to liberate phenylamine after its preparation. Quaternary ammonium salts with a long hydrocarbon chain act as cationic surfactants, used in fabric softeners and hair conditioners, which is a common applied context in AQA questions.

Try this

Q1. Why is a primary aliphatic amine a stronger base than ammonia? [2 marks]

  • Cue. The alkyl group pushes electron density onto N, making the lone pair more available to accept H+H^+.

Q2. Name the reagents used to reduce nitrobenzene to phenylamine. [1 mark]

  • Cue. Tin and concentrated hydrochloric acid (then NaOHNaOH).

Exam-style practice questions

Practice questions written in the style of AQA exam questions on this dot point, with worked answer explainers. The year tag is the paper they imitate, not the source.

AQA 20194 marksExplain why ethylamine is a stronger base than ammonia, and why phenylamine is a weaker base than ammonia.
Show worked answer →

Amines are bases because the nitrogen lone pair accepts a proton; the more available that lone pair, the stronger the base.

Ethylamine is stronger than ammonia because the ethyl group is electron-releasing (a positive inductive effect), pushing electron density onto the nitrogen and making the lone pair more available to accept a proton.

Phenylamine is weaker than ammonia because the nitrogen lone pair is partly delocalised into the benzene ring, so it is less available to accept a proton.

Markers reward the lone-pair availability principle, the inductive effect raising basicity in ethylamine, and the delocalisation into the ring lowering it in phenylamine.

AQA 20213 marksDescribe how phenylamine is prepared from benzene in two stages, giving the reagents and conditions for each stage.
Show worked answer →

Stage 1, nitration: react benzene with a mixture of concentrated nitric acid and concentrated sulfuric acid at about 50 degrees Celsius to form nitrobenzene, C6H5NO2\text{C}_6\text{H}_5\text{NO}_2.

Stage 2, reduction: heat nitrobenzene with tin and concentrated hydrochloric acid (reflux), then add sodium hydroxide to liberate phenylamine, C6H5NH2\text{C}_6\text{H}_5\text{NH}_2, from its salt.

Markers reward the nitration reagents and temperature, the reduction with tin and concentrated HCl, and the final NaOH step to free the amine.

Related dot points

Sources & how we know this