Skip to main content
EnglandChemistrySyllabus dot point

How do carbonyl compounds react and how can you tell aldehydes from ketones?

Aldehydes and ketones as carbonyl compounds. Oxidation of aldehydes to carboxylic acids and the use of Tollens' and Fehling's reagents to distinguish them from ketones. Reduction with NaBH4 to alcohols. Nucleophilic addition of HCN to form hydroxynitriles and the production of a racemic mixture.

A focused answer to the AQA A-Level Chemistry 3.3.8 specification points on carbonyl compounds. Covers oxidation of aldehydes, distinguishing tests, reduction with NaBH4, and the nucleophilic addition of HCN with its mechanism and racemic outcome.

Generated by Claude Opus 4.810 min answer

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

Jump to a section
  1. What this dot point is asking
  2. The carbonyl group
  3. Oxidation and distinguishing tests
  4. Reduction with NaBH4NaBH_4
  5. Nucleophilic addition of HCN
  6. Try this

What this dot point is asking

AQA wants you to compare the reactions of aldehydes and ketones, oxidise aldehydes and use Tollens' and Fehling's tests to distinguish them from ketones, reduce carbonyls with NaBH4NaBH_4, and give the nucleophilic addition mechanism of HCN including why it gives a racemate.

The carbonyl group

The C=OC=O bond is polar because oxygen is more electronegative, giving the carbon a δ+\delta+ charge. This makes the carbon vulnerable to attack by nucleophiles, which is the basis of both the reduction by hydride and the addition of cyanide. In an aldehyde the carbonyl carbon carries at least one hydrogen (RCHO\text{RCHO}), so the molecule can be oxidised; in a ketone the carbonyl carbon sits between two carbon groups (RCOR\text{RCOR}'), so there is no hydrogen to remove and oxidation does not occur under mild conditions. This single structural difference explains why the distinguishing tests work, and the carbonyl carbon is sp2 hybridised and trigonal planar, which is why nucleophilic addition that creates a chiral centre gives a racemate.

Oxidation and distinguishing tests

Aldehydes are easily oxidised to carboxylic acids; ketones are not.

  • Tollens' reagent (ammoniacal silver nitrate): aldehyde gives a silver mirror; ketone, no change.
  • Fehling's solution: aldehyde turns it from blue to a brick-red precipitate of Cu2OCu_2O; ketone, no change.

Reduction with NaBH4NaBH_4

Sodium tetrahydridoborate(III), NaBH4NaBH_4, provides the hydride ion HH^- as the nucleophile. The mechanism is nucleophilic addition: the hydride attacks the δ+\delta+ carbonyl carbon, breaking the C=OC=O pi bond to give an alkoxide, which is then protonated to the alcohol.

  • Aldehyde to primary alcohol: CH3CHO+2[H]CH3CH2OHCH_3CHO + 2[H] \rightarrow CH_3CH_2OH
  • Ketone to secondary alcohol: CH3COCH3+2[H]CH3CH(OH)CH3CH_3COCH_3 + 2[H] \rightarrow CH_3CH(OH)CH_3

This is the exact reverse of the oxidation of alcohols by acidified dichromate, so the two reactions together let you move freely between alcohols and carbonyl compounds in a synthesis. NaBH4NaBH_4 is selective: it reduces the polar C=OC=O of an aldehyde or ketone but leaves a non-polar C=CC=C double bond untouched, which is useful when a molecule contains both.

Nucleophilic addition of HCN

Because the carbonyl carbon is planar, CNCN^- attacks from either side equally, creating a new chiral centre and producing a racemic mixture (optically inactive). The hydroxynitrile product is valuable in synthesis because it contains both an OH-OH group and a CN-CN group, and the nitrile can be hydrolysed to a carboxylic acid, giving a 2-hydroxy acid one carbon longer than the original carbonyl compound.

Try this

Q1. Name the product of reducing propanone with NaBH4NaBH_4. [1 mark]

  • Cue. Propan-2-ol.

Q2. Why does HCN addition to butanone give a racemic mixture? [2 marks]

  • Cue. The planar carbonyl is attacked equally from both faces, giving equal amounts of two enantiomers.

Exam-style practice questions

Practice questions written in the style of AQA exam questions on this dot point, with worked answer explainers. The year tag is the paper they imitate, not the source.

AQA 20194 marksA student has two unlabelled bottles, one containing propanal and one containing propanone. Describe a chemical test that distinguishes them, giving the reagent, the observation with each compound, and the reason for the difference.
Show worked answer →

Reagent: Tollens' reagent (ammoniacal silver nitrate), warmed gently (Fehling's solution is also acceptable).

Observation: propanal (an aldehyde) gives a silver mirror on the inside of the tube (or Fehling's turns from blue to a brick-red precipitate); propanone (a ketone) gives no change.

Reason: aldehydes are readily oxidised to carboxylic acids, reducing Ag+\text{Ag}^+ to silver metal (or Cu2+\text{Cu}^{2+} to Cu2O\text{Cu}_2\text{O}); ketones cannot be oxidised in this way, so they do not react.

Markers reward the named reagent, the correct observation for each, and the explanation in terms of the aldehyde being oxidised while the ketone is not.

AQA 20214 marksEthanal reacts with hydrogen cyanide to form 2-hydroxypropanenitrile. Outline the nucleophilic addition mechanism and explain why the product is a racemic mixture.
Show worked answer →

Mechanism: a lone pair on the cyanide ion, :CN:\text{CN}^-, attacks the δ+\delta+ carbonyl carbon (curly arrow from CN\text{CN}^- to the carbon), and the C=O\text{C}=\text{O} pi bond breaks (curly arrow from the double bond to the oxygen), giving a negatively charged alkoxide intermediate. This oxygen then gains a proton (from HCN) to form the OH-\text{OH} group, giving CH3CH(OH)CN\text{CH}_3\text{CH(OH)CN}.

Racemic mixture: the carbonyl carbon is trigonal planar, so the cyanide ion attacks from above or below the plane with equal probability. This creates a new chiral centre with both configurations in equal amounts, so the product is an optically inactive 50:50 mixture of enantiomers.

Markers reward the correct curly arrows, the alkoxide intermediate, protonation to the hydroxynitrile, and the planar-attack explanation of the racemate.

Related dot points

Sources & how we know this